C23H39NO4Si — CID 69233032
(4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-(4-methoxyanilino)-3,5-dimethylhex-2-enoic acid (PubChem CID 69233032) has the molecular formula C23H39NO4Si and a molecular weight of 421.65 g/mol. Its IUPAC name is (4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-(4-methoxyanilino)-3,5-dimethylhex-2-enoic acid.
| Compound Name | (4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-(4-methoxyanilino)-3,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 69233032 |
| Molecular Formula | C23H39NO4Si |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-(4-methoxyanilino)-3,5-dimethylhex-2-enoic acid |
| SMILES | CCC(C(=O)O)=C(C)[C@@H](Nc1ccc(OC)cc1)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39NO4Si/c1-10-20(22(25)26)17(3)21(24-18-11-13-19(27-7)14-12-18)16(2)15-28-29(8,9)23(4,5)6/h11-14,16,21,24H,10,15H2,1-9H3,(H,25,26)/t16-,21-/m0/s1 |
| InChIKey | XSPPUYRMBSMPHC-KKSFZXQISA-N |
| XLogP | 5.94 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|