C22H38O4Si — CID 134841574
(E,2R,3S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,5-dimethylhex-4-en-3-ol (PubChem CID 134841574) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (E,2R,3S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,5-dimethylhex-4-en-3-ol.
| Compound Name | (E,2R,3S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,5-dimethylhex-4-en-3-ol |
|---|---|
| PubChem CID | 134841574 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (E,2R,3S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,5-dimethylhex-4-en-3-ol |
| SMILES | COc1ccc(COC[C@@H](C)[C@@H](O)/C=C(\C)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H38O4Si/c1-17(14-26-27(7,8)22(3,4)5)13-21(23)18(2)15-25-16-19-9-11-20(24-6)12-10-19/h9-13,18,21,23H,14-16H2,1-8H3/b17-13+/t18-,21+/m1/s1 |
| InChIKey | LBSMADLHZCDVHR-IUPPMXBZSA-N |
| XLogP | 5.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|