C13H29BO4Si — CID 101128575
[(E,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpent-1-enyl]boronic acid (PubChem CID 101128575) has the molecular formula C13H29BO4Si and a molecular weight of 288.27 g/mol. Its IUPAC name is [(E,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpent-1-enyl]boronic acid.
| Compound Name | [(E,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpent-1-enyl]boronic acid |
|---|---|
| PubChem CID | 101128575 |
| Molecular Formula | C13H29BO4Si |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(E,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpent-1-enyl]boronic acid |
| SMILES | CO[C@@H](/C=C/B(O)O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H29BO4Si/c1-11(12(17-5)8-9-14(15)16)10-18-19(6,7)13(2,3)4/h8-9,11-12,15-16H,10H2,1-7H3/b9-8+/t11-,12+/m1/s1 |
| InChIKey | JUXLZDGKKAVATA-DGTDAXKGSA-N |
| XLogP | 2.23 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|