C13H28O2Si — CID 13198877
5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-en-3-ol (PubChem CID 13198877) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-en-3-ol.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-en-3-ol |
|---|---|
| PubChem CID | 13198877 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-en-3-ol |
| SMILES | C=C(C)C(O)C(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-10(2)12(14)11(3)9-15-16(7,8)13(4,5)6/h11-12,14H,1,9H2,2-8H3 |
| InChIKey | XEOZFBOVVSTMMM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|