C17H36O2SSi — CID 10854068
(E,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1-tert-butylsulfanyl-2,4-dimethylpent-1-en-3-ol (PubChem CID 10854068) has the molecular formula C17H36O2SSi and a molecular weight of 332.63 g/mol. Its IUPAC name is (E,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1-tert-butylsulfanyl-2,4-dimethylpent-1-en-3-ol.
| Compound Name | (E,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1-tert-butylsulfanyl-2,4-dimethylpent-1-en-3-ol |
|---|---|
| PubChem CID | 10854068 |
| Molecular Formula | C17H36O2SSi |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (E,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-1-tert-butylsulfanyl-2,4-dimethylpent-1-en-3-ol |
| SMILES | C/C(=C\SC(C)(C)C)[C@@H](O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O2SSi/c1-13(11-19-21(9,10)17(6,7)8)15(18)14(2)12-20-16(3,4)5/h12-13,15,18H,11H2,1-10H3/b14-12+/t13-,15+/m1/s1 |
| InChIKey | MZDUKSOHPVIKGO-PDPOEPHVSA-N |
| XLogP | 5.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|