C13H30BO4Si+ — CID 134971949
[[(E,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpent-1-enyl]-hydroxyboranyl]oxidanium (PubChem CID 134971949) has the molecular formula C13H30BO4Si+ and a molecular weight of 289.28 g/mol. Its IUPAC name is [[(E,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpent-1-enyl]-hydroxyboranyl]oxidanium.
| Compound Name | [[(E,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpent-1-enyl]-hydroxyboranyl]oxidanium |
|---|---|
| PubChem CID | 134971949 |
| Molecular Formula | C13H30BO4Si+ |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | [[(E,3R,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-4-methylpent-1-enyl]-hydroxyboranyl]oxidanium |
| SMILES | CO[C@H](/C=C/B(O)[OH2+])[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H29BO4Si/c1-11(12(17-5)8-9-14(15)16)10-18-19(6,7)13(2,3)4/h8-9,11-12,15-16H,10H2,1-7H3/p+1/b9-8+/t11-,12-/m1/s1 |
| InChIKey | JUXLZDGKKAVATA-SVKHLYGUSA-O |
| XLogP | 1.96 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|