C11H23IOSi — CID 101405389
tert-butyl-[(E)-4-iodo-2-methylbut-3-enoxy]-dimethylsilane (PubChem CID 101405389) has the molecular formula C11H23IOSi and a molecular weight of 326.29 g/mol. Its IUPAC name is tert-butyl-[(E)-4-iodo-2-methylbut-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-iodo-2-methylbut-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101405389 |
| Molecular Formula | C11H23IOSi |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | tert-butyl-[(E)-4-iodo-2-methylbut-3-enoxy]-dimethylsilane |
| SMILES | CC(/C=C/I)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H23IOSi/c1-10(7-8-12)9-13-14(5,6)11(2,3)4/h7-8,10H,9H2,1-6H3/b8-7+ |
| InChIKey | VKZXLSRFOOQEOR-BQYQJAHWSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|