C20H38O3Si — CID 46915894
tert-butyl (1S,2S,3R)-2-[(E,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-1-enyl]-3-methylcyclopropane-1-carboxylate (PubChem CID 46915894) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is tert-butyl (1S,2S,3R)-2-[(E,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-1-enyl]-3-methylcyclopropane-1-carboxylate.
| Compound Name | tert-butyl (1S,2S,3R)-2-[(E,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-1-enyl]-3-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 46915894 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | tert-butyl (1S,2S,3R)-2-[(E,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-1-enyl]-3-methylcyclopropane-1-carboxylate |
| SMILES | C[C@@H]1[C@H](/C=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-14(13-22-24(9,10)20(6,7)8)11-12-16-15(2)17(16)18(21)23-19(3,4)5/h11-12,14-17H,13H2,1-10H3/b12-11+/t14-,15-,16+,17+/m1/s1 |
| InChIKey | AMOVQVCXGDQJPF-WWOXGQTFSA-N |
| XLogP | 5.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|