C15H33NO3Si — CID 87652886
tert-butyl 2-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-ylamino]acetate (PubChem CID 87652886) has the molecular formula C15H33NO3Si and a molecular weight of 303.52 g/mol. Its IUPAC name is tert-butyl 2-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-ylamino]acetate.
| Compound Name | tert-butyl 2-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-ylamino]acetate |
|---|---|
| PubChem CID | 87652886 |
| Molecular Formula | C15H33NO3Si |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | tert-butyl 2-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-ylamino]acetate |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H33NO3Si/c1-12(11-18-20(8,9)15(5,6)7)16-10-13(17)19-14(2,3)4/h12,16H,10-11H2,1-9H3 |
| InChIKey | JYGPCYNPPSXPGE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|