C16H33NO4SSi — CID 154025289
S-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] ethanethioate (PubChem CID 154025289) has the molecular formula C16H33NO4SSi and a molecular weight of 363.60 g/mol. Its IUPAC name is S-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] ethanethioate.
| Compound Name | S-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 154025289 |
| Molecular Formula | C16H33NO4SSi |
| Molecular Weight | 363.60 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | S-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H](CNC(=O)OC(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO4SSi/c1-12(18)22-13(10-17-14(19)21-15(2,3)4)11-20-23(8,9)16(5,6)7/h13H,10-11H2,1-9H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | RACXGYGEJRFVRE-ZDUSSCGKSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|