C12H22N2O4S — CID 21268892
S-[1-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propan-2-yl] ethanethioate (PubChem CID 21268892) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is S-[1-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propan-2-yl] ethanethioate.
| Compound Name | S-[1-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 21268892 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | S-[1-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]propan-2-yl] ethanethioate |
| SMILES | CC(=O)SC(C)CNC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O4S/c1-8(19-9(2)15)6-13-10(16)7-14-11(17)18-12(3,4)5/h8H,6-7H2,1-5H3,(H,13,16)(H,14,17) |
| InChIKey | CKLGKJDXQLAKFA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|