C25H49N3O6 — CID 155196466
tert-butyl N-[4-methyl-3,3-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pentyl]carbamate (PubChem CID 155196466) has the molecular formula C25H49N3O6 and a molecular weight of 487.68 g/mol. Its IUPAC name is tert-butyl N-[4-methyl-3,3-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pentyl]carbamate.
| Compound Name | tert-butyl N-[4-methyl-3,3-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pentyl]carbamate |
|---|---|
| PubChem CID | 155196466 |
| Molecular Formula | C25H49N3O6 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.36 |
| IUPAC Name | tert-butyl N-[4-methyl-3,3-bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]pentyl]carbamate |
| SMILES | CC(C)C(CCNC(=O)OC(C)(C)C)(CCNC(=O)OC(C)(C)C)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H49N3O6/c1-18(2)25(12-15-26-19(29)32-22(3,4)5,13-16-27-20(30)33-23(6,7)8)14-17-28-21(31)34-24(9,10)11/h18H,12-17H2,1-11H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | SHLOVESCYKZWAO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|