C14H31NO4Si — CID 140880873
tert-butyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]carbamate (PubChem CID 140880873) has the molecular formula C14H31NO4Si and a molecular weight of 305.49 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 140880873 |
| Molecular Formula | C14H31NO4Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl N-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO4Si/c1-13(2,3)18-12(17)15-9-11(10-16)19-20(7,8)14(4,5)6/h11,16H,9-10H2,1-8H3,(H,15,17)/t11-/m1/s1 |
| InChIKey | VFDHDMONRHQELN-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|