C10H21NO4 — CID 87486747
tert-butyl N-[(2R)-2,3-dimethoxypropyl]carbamate (PubChem CID 87486747) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2,3-dimethoxypropyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2,3-dimethoxypropyl]carbamate |
|---|---|
| PubChem CID | 87486747 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | tert-butyl N-[(2R)-2,3-dimethoxypropyl]carbamate |
| SMILES | COC[C@@H](CNC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C10H21NO4/c1-10(2,3)15-9(12)11-6-8(14-5)7-13-4/h8H,6-7H2,1-5H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | PQYBOHSCYPTACI-MRVPVSSYSA-N |
| XLogP | 1.17 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |