C17H27NO5 — CID 58242020
tert-butyl N-[(2R)-3-[2-(2-hydroxyethoxy)phenyl]-2-methoxypropyl]carbamate (PubChem CID 58242020) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-[2-(2-hydroxyethoxy)phenyl]-2-methoxypropyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-[2-(2-hydroxyethoxy)phenyl]-2-methoxypropyl]carbamate |
|---|---|
| PubChem CID | 58242020 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | tert-butyl N-[(2R)-3-[2-(2-hydroxyethoxy)phenyl]-2-methoxypropyl]carbamate |
| SMILES | CO[C@@H](CNC(=O)OC(C)(C)C)Cc1ccccc1OCCO |
| InChI | InChI=1S/C17H27NO5/c1-17(2,3)23-16(20)18-12-14(21-4)11-13-7-5-6-8-15(13)22-10-9-19/h5-8,14,19H,9-12H2,1-4H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | YCZBCRMDXQTKEO-CQSZACIVSA-N |
| XLogP | 2.14 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |