C13H21ClN2O4 — CID 120992179
2-amino-N-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-methoxypropanamide;hydrochloride (PubChem CID 120992179) has the molecular formula C13H21ClN2O4 and a molecular weight of 304.77 g/mol. Its IUPAC name is 2-amino-N-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-methoxypropanamide;hydrochloride.
| Compound Name | 2-amino-N-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-methoxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 120992179 |
| Molecular Formula | C13H21ClN2O4 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-amino-N-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-methoxypropanamide;hydrochloride |
| SMILES | COCC(N)C(=O)NCc1ccccc1OCCO.Cl |
| InChI | InChI=1S/C13H20N2O4.ClH/c1-18-9-11(14)13(17)15-8-10-4-2-3-5-12(10)19-7-6-16;/h2-5,11,16H,6-9,14H2,1H3,(H,15,17);1H |
| InChIKey | LRYCKPDZOPJTMT-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |