C13H20N2O3 — CID 120992441
2-amino-3-methoxy-N-[(2-methoxy-4-methylphenyl)methyl]propanamide (PubChem CID 120992441) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-[(2-methoxy-4-methylphenyl)methyl]propanamide.
| Compound Name | 2-amino-3-methoxy-N-[(2-methoxy-4-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 120992441 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-amino-3-methoxy-N-[(2-methoxy-4-methylphenyl)methyl]propanamide |
| SMILES | COCC(N)C(=O)NCc1ccc(C)cc1OC |
| InChI | InChI=1S/C13H20N2O3/c1-9-4-5-10(12(6-9)18-3)7-15-13(16)11(14)8-17-2/h4-6,11H,7-8,14H2,1-3H3,(H,15,16) |
| InChIKey | ZIWNQRQESFABTF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |