C13H20ClN3O4 — CID 119956336
2-amino-N-[(2,4-dimethoxyphenyl)methyl]butanediamide;hydrochloride (PubChem CID 119956336) has the molecular formula C13H20ClN3O4 and a molecular weight of 317.77 g/mol. Its IUPAC name is 2-amino-N-[(2,4-dimethoxyphenyl)methyl]butanediamide;hydrochloride.
| Compound Name | 2-amino-N-[(2,4-dimethoxyphenyl)methyl]butanediamide;hydrochloride |
|---|---|
| PubChem CID | 119956336 |
| Molecular Formula | C13H20ClN3O4 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-amino-N-[(2,4-dimethoxyphenyl)methyl]butanediamide;hydrochloride |
| SMILES | COc1ccc(CNC(=O)C(N)CC(N)=O)c(OC)c1.Cl |
| InChI | InChI=1S/C13H19N3O4.ClH/c1-19-9-4-3-8(11(5-9)20-2)7-16-13(18)10(14)6-12(15)17;/h3-5,10H,6-7,14H2,1-2H3,(H2,15,17)(H,16,18);1H |
| InChIKey | MTUWMCHDDGAQCQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |