C13H19N3O4 — CID 131861350
(2S)-2-amino-N-[(2,3-dimethoxyphenyl)methyl]butanediamide (PubChem CID 131861350) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2,3-dimethoxyphenyl)methyl]butanediamide.
| Compound Name | (2S)-2-amino-N-[(2,3-dimethoxyphenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 131861350 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2S)-2-amino-N-[(2,3-dimethoxyphenyl)methyl]butanediamide |
| SMILES | COc1cccc(CNC(=O)[C@@H](N)CC(N)=O)c1OC |
| InChI | InChI=1S/C13H19N3O4/c1-19-10-5-3-4-8(12(10)20-2)7-16-13(18)9(14)6-11(15)17/h3-5,9H,6-7,14H2,1-2H3,(H2,15,17)(H,16,18)/t9-/m0/s1 |
| InChIKey | QMPGJEHHHXEBML-VIFPVBQESA-N |
| XLogP | -0.48 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |