C11H16N4O3 — CID 54927008
2-amino-N-[(2-methoxy-3-pyridinyl)methyl]butanediamide (PubChem CID 54927008) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-amino-N-[(2-methoxy-3-pyridinyl)methyl]butanediamide.
| Compound Name | 2-amino-N-[(2-methoxy-3-pyridinyl)methyl]butanediamide |
|---|---|
| PubChem CID | 54927008 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-amino-N-[(2-methoxy-3-pyridinyl)methyl]butanediamide |
| SMILES | COc1ncccc1CNC(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C11H16N4O3/c1-18-11-7(3-2-4-14-11)6-15-10(17)8(12)5-9(13)16/h2-4,8H,5-6,12H2,1H3,(H2,13,16)(H,15,17) |
| InChIKey | KEDZWIJBARHZBM-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |