C16H19N3O4 — CID 56741172
(2S)-2-amino-3-hydroxy-N-[[2-(2-methoxyphenoxy)-3-pyridinyl]methyl]propanamide (PubChem CID 56741172) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxy-N-[[2-(2-methoxyphenoxy)-3-pyridinyl]methyl]propanamide.
| Compound Name | (2S)-2-amino-3-hydroxy-N-[[2-(2-methoxyphenoxy)-3-pyridinyl]methyl]propanamide |
|---|---|
| PubChem CID | 56741172 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2S)-2-amino-3-hydroxy-N-[[2-(2-methoxyphenoxy)-3-pyridinyl]methyl]propanamide |
| SMILES | COc1ccccc1Oc1ncccc1CNC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C16H19N3O4/c1-22-13-6-2-3-7-14(13)23-16-11(5-4-8-18-16)9-19-15(21)12(17)10-20/h2-8,12,20H,9-10,17H2,1H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | IWVGCBOPKZFEOZ-LBPRGKRZSA-N |
| XLogP | 0.82 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |