C12H25NO4 — CID 106508903
tert-butyl N-[2-(hydroxymethyl)-5-methoxypentyl]carbamate (PubChem CID 106508903) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-5-methoxypentyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-5-methoxypentyl]carbamate |
|---|---|
| PubChem CID | 106508903 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-5-methoxypentyl]carbamate |
| SMILES | COCCCC(CO)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO4/c1-12(2,3)17-11(15)13-8-10(9-14)6-5-7-16-4/h10,14H,5-9H2,1-4H3,(H,13,15) |
| InChIKey | RTNNXEKFEZCSEB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|