C14H29NO4 — CID 106508788
tert-butyl N-[2-(hydroxymethyl)-6-methoxy-2-methylhexyl]carbamate (PubChem CID 106508788) has the molecular formula C14H29NO4 and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-6-methoxy-2-methylhexyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-6-methoxy-2-methylhexyl]carbamate |
|---|---|
| PubChem CID | 106508788 |
| Molecular Formula | C14H29NO4 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-6-methoxy-2-methylhexyl]carbamate |
| SMILES | COCCCCC(C)(CO)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29NO4/c1-13(2,3)19-12(17)15-10-14(4,11-16)8-6-7-9-18-5/h16H,6-11H2,1-5H3,(H,15,17) |
| InChIKey | BDXSHXCIOXQGQW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|