C14H29NO5S — CID 106730843
tert-butyl N-[2-(hydroxymethyl)-2-methyl-4-propan-2-ylsulfonylbutyl]carbamate (PubChem CID 106730843) has the molecular formula C14H29NO5S and a molecular weight of 323.46 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-2-methyl-4-propan-2-ylsulfonylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-2-methyl-4-propan-2-ylsulfonylbutyl]carbamate |
|---|---|
| PubChem CID | 106730843 |
| Molecular Formula | C14H29NO5S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-2-methyl-4-propan-2-ylsulfonylbutyl]carbamate |
| SMILES | CC(C)S(=O)(=O)CCC(C)(CO)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29NO5S/c1-11(2)21(18,19)8-7-14(6,10-16)9-15-12(17)20-13(3,4)5/h11,16H,7-10H2,1-6H3,(H,15,17) |
| InChIKey | WFLUBFMHQRIEEO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |