C15H29NO5S — CID 106730790
tert-butyl N-[2-cyclopropyl-4-ethylsulfonyl-2-(hydroxymethyl)butyl]carbamate (PubChem CID 106730790) has the molecular formula C15H29NO5S and a molecular weight of 335.47 g/mol. Its IUPAC name is tert-butyl N-[2-cyclopropyl-4-ethylsulfonyl-2-(hydroxymethyl)butyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclopropyl-4-ethylsulfonyl-2-(hydroxymethyl)butyl]carbamate |
|---|---|
| PubChem CID | 106730790 |
| Molecular Formula | C15H29NO5S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl N-[2-cyclopropyl-4-ethylsulfonyl-2-(hydroxymethyl)butyl]carbamate |
| SMILES | CCS(=O)(=O)CCC(CO)(CNC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C15H29NO5S/c1-5-22(19,20)9-8-15(11-17,12-6-7-12)10-16-13(18)21-14(2,3)4/h12,17H,5-11H2,1-4H3,(H,16,18) |
| InChIKey | BWMKOVCWHWVYBF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |