C9H19NO5S — CID 15539257
tert-butyl N-[2-(2-hydroxyethylsulfonyl)ethyl]carbamate (PubChem CID 15539257) has the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. Its IUPAC name is tert-butyl N-[2-(2-hydroxyethylsulfonyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-hydroxyethylsulfonyl)ethyl]carbamate |
|---|---|
| PubChem CID | 15539257 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | tert-butyl N-[2-(2-hydroxyethylsulfonyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCS(=O)(=O)CCO |
| InChI | InChI=1S/C9H19NO5S/c1-9(2,3)15-8(12)10-4-6-16(13,14)7-5-11/h11H,4-7H2,1-3H3,(H,10,12) |
| InChIKey | BHYGDWGGIGRORN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |