C7H17N3O4S — CID 86657941
tert-butyl N-[2-(sulfamoylamino)ethyl]carbamate (PubChem CID 86657941) has the molecular formula C7H17N3O4S and a molecular weight of 239.30 g/mol. Its IUPAC name is tert-butyl N-[2-(sulfamoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(sulfamoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 86657941 |
| Molecular Formula | C7H17N3O4S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | tert-butyl N-[2-(sulfamoylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNS(N)(=O)=O |
| InChI | InChI=1S/C7H17N3O4S/c1-7(2,3)14-6(11)9-4-5-10-15(8,12)13/h10H,4-5H2,1-3H3,(H,9,11)(H2,8,12,13) |
| InChIKey | DYCUAXHBULVZRW-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|