C11H24N2O4S — CID 87723579
tert-butyl N-[4-(methanesulfonamido)pentyl]carbamate (PubChem CID 87723579) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is tert-butyl N-[4-(methanesulfonamido)pentyl]carbamate.
| Compound Name | tert-butyl N-[4-(methanesulfonamido)pentyl]carbamate |
|---|---|
| PubChem CID | 87723579 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl N-[4-(methanesulfonamido)pentyl]carbamate |
| SMILES | CC(CCCNC(=O)OC(C)(C)C)NS(C)(=O)=O |
| InChI | InChI=1S/C11H24N2O4S/c1-9(13-18(5,15)16)7-6-8-12-10(14)17-11(2,3)4/h9,13H,6-8H2,1-5H3,(H,12,14) |
| InChIKey | HJRIMFFKPIEHHH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|