C8H22N2O2 — CID 144504271
tert-butyl N-[2-(methylamino)ethyl]carbamate;molecular hydrogen (PubChem CID 144504271) has the molecular formula C8H22N2O2 and a molecular weight of 178.28 g/mol. Its IUPAC name is tert-butyl N-[2-(methylamino)ethyl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[2-(methylamino)ethyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 144504271 |
| Molecular Formula | C8H22N2O2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | tert-butyl N-[2-(methylamino)ethyl]carbamate;molecular hydrogen |
| SMILES | CNCCNC(=O)OC(C)(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C8H18N2O2.2H2/c1-8(2,3)12-7(11)10-6-5-9-4;;/h9H,5-6H2,1-4H3,(H,10,11);2*1H |
| InChIKey | KMSVOKTUJDIUEJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|