C7H16BNO2 — CID 165117112
CID 165117112 (PubChem CID 165117112) has the molecular formula C7H16BNO2 and a molecular weight of 157.02 g/mol.
| Compound Name | CID 165117112 |
|---|---|
| PubChem CID | 165117112 |
| Molecular Formula | C7H16BNO2 |
| Molecular Weight | 157.02 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | — |
| SMILES | [B]CCNC(=O)OC(C)(C)C.[H][H] |
| InChI | InChI=1S/C7H14BNO2.H2/c1-7(2,3)11-6(10)9-5-4-8;/h4-5H2,1-3H3,(H,9,10);1H |
| InChIKey | KQWJBCYOYANDII-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.02 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|