C9H18N2O6S — CID 114518058
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]acetic acid (PubChem CID 114518058) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]acetic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]acetic acid |
|---|---|
| PubChem CID | 114518058 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfamoyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCNS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C9H18N2O6S/c1-9(2,3)17-8(14)10-4-5-11-18(15,16)6-7(12)13/h11H,4-6H2,1-3H3,(H,10,14)(H,12,13) |
| InChIKey | LTUDAPFPUQHGPI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|