C14H32N2O4SSi — CID 10665725
tert-butyl N-[4-(2-trimethylsilylethylsulfonylamino)butyl]carbamate (PubChem CID 10665725) has the molecular formula C14H32N2O4SSi and a molecular weight of 352.57 g/mol. Its IUPAC name is tert-butyl N-[4-(2-trimethylsilylethylsulfonylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-trimethylsilylethylsulfonylamino)butyl]carbamate |
|---|---|
| PubChem CID | 10665725 |
| Molecular Formula | C14H32N2O4SSi |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | tert-butyl N-[4-(2-trimethylsilylethylsulfonylamino)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNS(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C14H32N2O4SSi/c1-14(2,3)20-13(17)15-9-7-8-10-16-21(18,19)11-12-22(4,5)6/h16H,7-12H2,1-6H3,(H,15,17) |
| InChIKey | FVTXIQNOGWESRK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|