C15H29BrN2O4 — CID 15186009
tert-butyl N-[4-bromo-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butyl]carbamate (PubChem CID 15186009) has the molecular formula C15H29BrN2O4 and a molecular weight of 381.31 g/mol. Its IUPAC name is tert-butyl N-[4-bromo-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-bromo-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butyl]carbamate |
|---|---|
| PubChem CID | 15186009 |
| Molecular Formula | C15H29BrN2O4 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | tert-butyl N-[4-bromo-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(CCBr)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29BrN2O4/c1-14(2,3)21-12(19)17-9-11(7-8-16)10-18-13(20)22-15(4,5)6/h11H,7-10H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | UIAQCOFDTVNUBK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|