C17H38BrNO4 — CID 166148501
1-bromo-3-methylbutane;tert-butyl N-(2-hydroxyethyl)carbamate;3-methylbutan-1-ol (PubChem CID 166148501) has the molecular formula C17H38BrNO4 and a molecular weight of 400.40 g/mol. Its IUPAC name is 1-bromo-3-methylbutane;tert-butyl N-(2-hydroxyethyl)carbamate;3-methylbutan-1-ol.
| Compound Name | 1-bromo-3-methylbutane;tert-butyl N-(2-hydroxyethyl)carbamate;3-methylbutan-1-ol |
|---|---|
| PubChem CID | 166148501 |
| Molecular Formula | C17H38BrNO4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-bromo-3-methylbutane;tert-butyl N-(2-hydroxyethyl)carbamate;3-methylbutan-1-ol |
| SMILES | CC(C)(C)OC(=O)NCCO.CC(C)CCBr.CC(C)CCO |
| InChI | InChI=1S/C7H15NO3.C5H11Br.C5H12O/c1-7(2,3)11-6(10)8-4-5-9;2*1-5(2)3-4-6/h9H,4-5H2,1-3H3,(H,8,10);5H,3-4H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | UYBUMYVLAYMXRS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|