C14H28BrNO5 — CID 165489237
tert-butyl N-[3-bromo-2-(1,3-dimethoxypropan-2-yloxy)-2-methylpropyl]carbamate (PubChem CID 165489237) has the molecular formula C14H28BrNO5 and a molecular weight of 370.28 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-2-(1,3-dimethoxypropan-2-yloxy)-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-bromo-2-(1,3-dimethoxypropan-2-yloxy)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 165489237 |
| Molecular Formula | C14H28BrNO5 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | tert-butyl N-[3-bromo-2-(1,3-dimethoxypropan-2-yloxy)-2-methylpropyl]carbamate |
| SMILES | COCC(COC)OC(C)(CBr)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28BrNO5/c1-13(2,3)21-12(17)16-10-14(4,9-15)20-11(7-18-5)8-19-6/h11H,7-10H2,1-6H3,(H,16,17) |
| InChIKey | SHEQBCFXYCKZQM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|