C13H26BrNO3 — CID 114772777
tert-butyl N-[3-bromo-2-methyl-2-(2-methylpropoxy)propyl]carbamate (PubChem CID 114772777) has the molecular formula C13H26BrNO3 and a molecular weight of 324.26 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-2-methyl-2-(2-methylpropoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-bromo-2-methyl-2-(2-methylpropoxy)propyl]carbamate |
|---|---|
| PubChem CID | 114772777 |
| Molecular Formula | C13H26BrNO3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | tert-butyl N-[3-bromo-2-methyl-2-(2-methylpropoxy)propyl]carbamate |
| SMILES | CC(C)COC(C)(CBr)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26BrNO3/c1-10(2)7-17-13(6,8-14)9-15-11(16)18-12(3,4)5/h10H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | PREQWQVICLNUTE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|