C16H30BrNO4 — CID 165489441
tert-butyl N-[3-bromo-2-[2-(cyclobutylmethoxy)ethoxy]-2-methylpropyl]carbamate (PubChem CID 165489441) has the molecular formula C16H30BrNO4 and a molecular weight of 380.32 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-2-[2-(cyclobutylmethoxy)ethoxy]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-bromo-2-[2-(cyclobutylmethoxy)ethoxy]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 165489441 |
| Molecular Formula | C16H30BrNO4 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | tert-butyl N-[3-bromo-2-[2-(cyclobutylmethoxy)ethoxy]-2-methylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(CBr)OCCOCC1CCC1 |
| InChI | InChI=1S/C16H30BrNO4/c1-15(2,3)22-14(19)18-12-16(4,11-17)21-9-8-20-10-13-6-5-7-13/h13H,5-12H2,1-4H3,(H,18,19) |
| InChIKey | YGNQSJCAODNZCV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|