C15H28INO4 — CID 165493519
tert-butyl N-[2-(2-cyclobutyloxyethoxy)-3-iodo-2-methylpropyl]carbamate (PubChem CID 165493519) has the molecular formula C15H28INO4 and a molecular weight of 413.30 g/mol. Its IUPAC name is tert-butyl N-[2-(2-cyclobutyloxyethoxy)-3-iodo-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-cyclobutyloxyethoxy)-3-iodo-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 165493519 |
| Molecular Formula | C15H28INO4 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | tert-butyl N-[2-(2-cyclobutyloxyethoxy)-3-iodo-2-methylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(CI)OCCOC1CCC1 |
| InChI | InChI=1S/C15H28INO4/c1-14(2,3)21-13(18)17-11-15(4,10-16)20-9-8-19-12-6-5-7-12/h12H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | QKLUJMTUQAWAJB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|