C15H28INO3 — CID 165489568
tert-butyl N-[3-iodo-2-methyl-2-(3-methylcyclopentyl)oxypropyl]carbamate (PubChem CID 165489568) has the molecular formula C15H28INO3 and a molecular weight of 397.30 g/mol. Its IUPAC name is tert-butyl N-[3-iodo-2-methyl-2-(3-methylcyclopentyl)oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-iodo-2-methyl-2-(3-methylcyclopentyl)oxypropyl]carbamate |
|---|---|
| PubChem CID | 165489568 |
| Molecular Formula | C15H28INO3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | tert-butyl N-[3-iodo-2-methyl-2-(3-methylcyclopentyl)oxypropyl]carbamate |
| SMILES | CC1CCC(OC(C)(CI)CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28INO3/c1-11-6-7-12(8-11)19-15(5,9-16)10-17-13(18)20-14(2,3)4/h11-12H,6-10H2,1-5H3,(H,17,18) |
| InChIKey | FTUUEYSDMHDSJU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|