C16H30INO3 — CID 114772711
tert-butyl N-[3-iodo-2-methyl-2-(4-methylcyclohexyl)oxypropyl]carbamate (PubChem CID 114772711) has the molecular formula C16H30INO3 and a molecular weight of 411.32 g/mol. Its IUPAC name is tert-butyl N-[3-iodo-2-methyl-2-(4-methylcyclohexyl)oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-iodo-2-methyl-2-(4-methylcyclohexyl)oxypropyl]carbamate |
|---|---|
| PubChem CID | 114772711 |
| Molecular Formula | C16H30INO3 |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | tert-butyl N-[3-iodo-2-methyl-2-(4-methylcyclohexyl)oxypropyl]carbamate |
| SMILES | CC1CCC(OC(C)(CI)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30INO3/c1-12-6-8-13(9-7-12)20-16(5,10-17)11-18-14(19)21-15(2,3)4/h12-13H,6-11H2,1-5H3,(H,18,19) |
| InChIKey | ODRLUPBUGXVVAG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|