C13H26INO3 — CID 114772203
tert-butyl N-[3-iodo-2-methyl-2-[(2-methylpropan-2-yl)oxy]propyl]carbamate (PubChem CID 114772203) has the molecular formula C13H26INO3 and a molecular weight of 371.26 g/mol. Its IUPAC name is tert-butyl N-[3-iodo-2-methyl-2-[(2-methylpropan-2-yl)oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-iodo-2-methyl-2-[(2-methylpropan-2-yl)oxy]propyl]carbamate |
|---|---|
| PubChem CID | 114772203 |
| Molecular Formula | C13H26INO3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | tert-butyl N-[3-iodo-2-methyl-2-[(2-methylpropan-2-yl)oxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(CI)OC(C)(C)C |
| InChI | InChI=1S/C13H26INO3/c1-11(2,3)17-10(16)15-9-13(7,8-14)18-12(4,5)6/h8-9H2,1-7H3,(H,15,16) |
| InChIKey | AAZFSBJFVVBBHC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|