C17H34INO3 — CID 104969647
tert-butyl N-(3-iodo-2-methyl-2-octan-2-yloxypropyl)carbamate (PubChem CID 104969647) has the molecular formula C17H34INO3 and a molecular weight of 427.37 g/mol. Its IUPAC name is tert-butyl N-(3-iodo-2-methyl-2-octan-2-yloxypropyl)carbamate.
| Compound Name | tert-butyl N-(3-iodo-2-methyl-2-octan-2-yloxypropyl)carbamate |
|---|---|
| PubChem CID | 104969647 |
| Molecular Formula | C17H34INO3 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | tert-butyl N-(3-iodo-2-methyl-2-octan-2-yloxypropyl)carbamate |
| SMILES | CCCCCCC(C)OC(C)(CI)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H34INO3/c1-7-8-9-10-11-14(2)21-17(6,12-18)13-19-15(20)22-16(3,4)5/h14H,7-13H2,1-6H3,(H,19,20) |
| InChIKey | CXDFADATOKVKED-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|