C19H39NO3 — CID 106507449
tert-butyl N-[2-(hydroxymethyl)-2-propyldecyl]carbamate (PubChem CID 106507449) has the molecular formula C19H39NO3 and a molecular weight of 329.53 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-2-propyldecyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-2-propyldecyl]carbamate |
|---|---|
| PubChem CID | 106507449 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-2-propyldecyl]carbamate |
| SMILES | CCCCCCCCC(CO)(CCC)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H39NO3/c1-6-8-9-10-11-12-14-19(16-21,13-7-2)15-20-17(22)23-18(3,4)5/h21H,6-16H2,1-5H3,(H,20,22) |
| InChIKey | ALZWXDLLLHYUQE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|