C17H33NO4 — CID 106507460
tert-butyl N-[2-(hydroxymethyl)-2-[(5-methyloxolan-2-yl)methyl]pentyl]carbamate (PubChem CID 106507460) has the molecular formula C17H33NO4 and a molecular weight of 315.45 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-2-[(5-methyloxolan-2-yl)methyl]pentyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-2-[(5-methyloxolan-2-yl)methyl]pentyl]carbamate |
|---|---|
| PubChem CID | 106507460 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-2-[(5-methyloxolan-2-yl)methyl]pentyl]carbamate |
| SMILES | CCCC(CO)(CNC(=O)OC(C)(C)C)CC1CCC(C)O1 |
| InChI | InChI=1S/C17H33NO4/c1-6-9-17(12-19,10-14-8-7-13(2)21-14)11-18-15(20)22-16(3,4)5/h13-14,19H,6-12H2,1-5H3,(H,18,20) |
| InChIKey | GHPYYBBMUSHRCF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |