C17H35NO3 — CID 106507949
tert-butyl N-[2-(hydroxymethyl)-2-(2-methylpropyl)heptyl]carbamate (PubChem CID 106507949) has the molecular formula C17H35NO3 and a molecular weight of 301.47 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-2-(2-methylpropyl)heptyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-2-(2-methylpropyl)heptyl]carbamate |
|---|---|
| PubChem CID | 106507949 |
| Molecular Formula | C17H35NO3 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-2-(2-methylpropyl)heptyl]carbamate |
| SMILES | CCCCCC(CO)(CNC(=O)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C17H35NO3/c1-7-8-9-10-17(13-19,11-14(2)3)12-18-15(20)21-16(4,5)6/h14,19H,7-13H2,1-6H3,(H,18,20) |
| InChIKey | VOKJNKMFCMEGTH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|