C18H37NO4 — CID 106507987
tert-butyl N-[2-(hydroxymethyl)-5-methoxy-5-methyl-2-(2-methylpropyl)hexyl]carbamate (PubChem CID 106507987) has the molecular formula C18H37NO4 and a molecular weight of 331.50 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-5-methoxy-5-methyl-2-(2-methylpropyl)hexyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-5-methoxy-5-methyl-2-(2-methylpropyl)hexyl]carbamate |
|---|---|
| PubChem CID | 106507987 |
| Molecular Formula | C18H37NO4 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-5-methoxy-5-methyl-2-(2-methylpropyl)hexyl]carbamate |
| SMILES | COC(C)(C)CCC(CO)(CNC(=O)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C18H37NO4/c1-14(2)11-18(13-20,10-9-17(6,7)22-8)12-19-15(21)23-16(3,4)5/h14,20H,9-13H2,1-8H3,(H,19,21) |
| InChIKey | VJMQCCQIAJINMZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |