C19H31NO3 — CID 106507424
tert-butyl N-[2-(hydroxymethyl)-4-methyl-2-(2-methylphenyl)pentyl]carbamate (PubChem CID 106507424) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-4-methyl-2-(2-methylphenyl)pentyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-4-methyl-2-(2-methylphenyl)pentyl]carbamate |
|---|---|
| PubChem CID | 106507424 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-4-methyl-2-(2-methylphenyl)pentyl]carbamate |
| SMILES | Cc1ccccc1C(CO)(CNC(=O)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C19H31NO3/c1-14(2)11-19(13-21,16-10-8-7-9-15(16)3)12-20-17(22)23-18(4,5)6/h7-10,14,21H,11-13H2,1-6H3,(H,20,22) |
| InChIKey | LWTXJSYIKNMUBF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |