C16H25NO3 — CID 106507429
tert-butyl N-[3-hydroxy-2-methyl-2-(2-methylphenyl)propyl]carbamate (PubChem CID 106507429) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-2-methyl-2-(2-methylphenyl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-2-methyl-2-(2-methylphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 106507429 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | tert-butyl N-[3-hydroxy-2-methyl-2-(2-methylphenyl)propyl]carbamate |
| SMILES | Cc1ccccc1C(C)(CO)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO3/c1-12-8-6-7-9-13(12)16(5,11-18)10-17-14(19)20-15(2,3)4/h6-9,18H,10-11H2,1-5H3,(H,17,19) |
| InChIKey | PNQQIMZQVWMGEO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |