C18H28FNO3 — CID 106506024
tert-butyl N-[2-(4-fluorophenyl)-2-(hydroxymethyl)-4-methylpentyl]carbamate (PubChem CID 106506024) has the molecular formula C18H28FNO3 and a molecular weight of 325.42 g/mol. Its IUPAC name is tert-butyl N-[2-(4-fluorophenyl)-2-(hydroxymethyl)-4-methylpentyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-fluorophenyl)-2-(hydroxymethyl)-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 106506024 |
| Molecular Formula | C18H28FNO3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | tert-butyl N-[2-(4-fluorophenyl)-2-(hydroxymethyl)-4-methylpentyl]carbamate |
| SMILES | CC(C)CC(CO)(CNC(=O)OC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H28FNO3/c1-13(2)10-18(12-21,14-6-8-15(19)9-7-14)11-20-16(22)23-17(3,4)5/h6-9,13,21H,10-12H2,1-5H3,(H,20,22) |
| InChIKey | SUUMOBQODCMYCQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |