C17H26FNO4 — CID 106507141
tert-butyl N-[2-(3-fluorophenyl)-2-(hydroxymethyl)-4-methoxybutyl]carbamate (PubChem CID 106507141) has the molecular formula C17H26FNO4 and a molecular weight of 327.40 g/mol. Its IUPAC name is tert-butyl N-[2-(3-fluorophenyl)-2-(hydroxymethyl)-4-methoxybutyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-fluorophenyl)-2-(hydroxymethyl)-4-methoxybutyl]carbamate |
|---|---|
| PubChem CID | 106507141 |
| Molecular Formula | C17H26FNO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | tert-butyl N-[2-(3-fluorophenyl)-2-(hydroxymethyl)-4-methoxybutyl]carbamate |
| SMILES | COCCC(CO)(CNC(=O)OC(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C17H26FNO4/c1-16(2,3)23-15(21)19-11-17(12-20,8-9-22-4)13-6-5-7-14(18)10-13/h5-7,10,20H,8-9,11-12H2,1-4H3,(H,19,21) |
| InChIKey | GBZRFXFQYVHVLV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |